Cefradine structure
|
Common Name | Cefradine | ||
|---|---|---|---|---|
| CAS Number | 38821-53-3 | Molecular Weight | 349.405 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 693.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H19N3O4S | Melting Point | 140-142ºC | |
| MSDS | Chinese USA | Flash Point | 373.0±31.5 °C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
Use of CefradineCefradine is a first generation cephalosporin antibiotic. |
| Name | cephradine |
|---|---|
| Synonym | More Synonyms |
| Description | Cefradine is a first generation cephalosporin antibiotic. |
|---|---|
| Related Catalog |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 693.1±55.0 °C at 760 mmHg |
| Melting Point | 140-142ºC |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.405 |
| Flash Point | 373.0±31.5 °C |
| Exact Mass | 349.109619 |
| PSA | 138.03000 |
| LogP | 0.98 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | RDLPVSKMFDYCOR-UEKVPHQBSA-N |
| SMILES | CC1=C(C(=O)O)N2C(=O)C(NC(=O)C(N)C3=CCC=CC3)C2SC1 |
| Storage condition | Store at 0-5°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H317-H319-H334-H335 |
| Precautionary Statements | P261-P280-P284-P304 + P340-P305 + P351 + P338-P342 + P311 |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38;R42/43 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| RTECS | XI0336000 |
| HS Code | 2941905400 |
| HS Code | 2941905400 |
|---|
|
Exploring the potential impact of an expanded genetic code on protein function.
Proc. Natl. Acad. Sci. U. S. A. 112 , 6961-6, (2015) With few exceptions, all living organisms encode the same 20 canonical amino acids; however, it remains an open question whether organisms with additional amino acids beyond the common 20 might have a... |
|
|
Algal Feedback and Removal Efficiency in a Sequencing Batch Reactor Algae Process (SBAR) to Treat the Antibiotic Cefradine.
PLoS ONE 10 , e0133273, (2015) Many previous studies focused on the removal capability for contaminants when the algae grown in an unexposed, unpolluted environment and ignored whether the feedback of algae to the toxic stress infl... |
|
|
Sensitive chemiluminescence determination of thirteen cephalosporin antibiotics with luminol-copper(II) reaction.
Appl. Spectrosc. 64(10) , 1154-9, (2010) A new chemiluminescence reaction, the luminol-Cu(2+) reaction, was investigated for the determination of thirteen (13) cephalosporin antibiotics, namely cefalexin, cefadroxil, cefradine, cefazolin sod... |
| Cefrag |
| Anspor |
| EINECS 254-137-8 |
| eskacef |
| Cefril |
| Cefradin Cephradine |
| (6R-(6alpha,7))-((Amino-1,4-cyclohexadien-1-ylacetyl)amino)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Dimacef |
| MFCD01743037 |
| Lisacef |
| 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[2-amino-2-(1,4-cyclohexadien-1-yl)acetyl]amino]-3-methyl-8-oxo- |
| 7-{[amino(cyclohexa-1,4-dien-1-yl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Cephradine |
| Cefradin,Cephradine |
| velosef |
| sefril |
| Cefro |
| 7-{[Amino(1,4-cyclohexadien-1-yl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Cefradine |