pentafluorobenzoyl-N-phenylethylamine structure
|
Common Name | pentafluorobenzoyl-N-phenylethylamine | ||
|---|---|---|---|---|
| CAS Number | 38842-14-7 | Molecular Weight | 315.23800 | |
| Density | 1.382g/cm3 | Boiling Point | 288.5ºC at 760mmHg | |
| Molecular Formula | C15H10F5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.3ºC | |
| Name | N-fluoro-N-(1,1,2,2-tetrafluoro-2-phenylethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 288.5ºC at 760mmHg |
| Molecular Formula | C15H10F5NO |
| Molecular Weight | 315.23800 |
| Flash Point | 128.3ºC |
| Exact Mass | 315.06800 |
| PSA | 20.31000 |
| LogP | 4.39810 |
| Index of Refraction | 1.516 |
| InChIKey | YAJMHGKJWGGGQE-UHFFFAOYSA-N |
| SMILES | O=C(NCCc1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2924299090 |
|---|
|
~%
pentafluorobenz... CAS#:38842-14-7 |
| Literature: Matin; Rowland Journal of pharmaceutical sciences, 1972 , vol. 61, # 8 p. 1235 - 1240 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(Pentafluorobenzoyl)phenethylamine |
| Benzamide,2,3,4,5,6-pentafluoro-N-(2-phenylethyl) |
| N-Phenethylpentafluorobenzamide |