5,8,9,10-tetrahydro-6h-[1,3]dioxolo[4,5-h]pyrrolo[2,1-b][3]benzazepin-6-one structure
|
Common Name | 5,8,9,10-tetrahydro-6h-[1,3]dioxolo[4,5-h]pyrrolo[2,1-b][3]benzazepin-6-one | ||
|---|---|---|---|---|
| CAS Number | 38847-96-0 | Molecular Weight | 243.25800 | |
| Density | 1.4g/cm3 | Boiling Point | 479ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | 5,8,9,10-tetrahydro-6h-[1,3]dioxolo[4,5-h]pyrrolo[2,1-b][3]benzazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 479ºC at 760 mmHg |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.25800 |
| Flash Point | 243.5ºC |
| Exact Mass | 243.09000 |
| PSA | 38.77000 |
| LogP | 1.87260 |
| Index of Refraction | 1.672 |
| InChIKey | FUKCQDGDFRZCOI-UHFFFAOYSA-N |
| SMILES | O=C1Cc2cc3c(cc2C=C2CCCN12)OCO3 |
|
~%
5,8,9,10-tetrah... CAS#:38847-96-0 |
| Literature: Weinreb; Auerbach Journal of the American Chemical Society, 1975 , vol. 97, # 9 p. 2503 - 2506 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 5,8,9,10-tetrahydro-[1,3]dioxolo[4',5':4,5]benzo[d]pyrrolo[1,2-a]azepin-6-one |