2-acetoxy-1-(5,8,9,10-tetrahydro-6H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d]pyrrolo[1,2-a]azepin-11-yl)-propan-1-one structure
|
Common Name | 2-acetoxy-1-(5,8,9,10-tetrahydro-6H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d]pyrrolo[1,2-a]azepin-11-yl)-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 38848-22-5 | Molecular Weight | 343.37400 | |
| Density | 1.33g/cm3 | Boiling Point | 523.7ºC at 760 mmHg | |
| Molecular Formula | C19H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.5ºC | |
| Name | 2-acetoxy-1-(5,8,9,10-tetrahydro-6H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d]pyrrolo[1,2-a]azepin-11-yl)-propan-1-one |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 523.7ºC at 760 mmHg |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.37400 |
| Flash Point | 270.5ºC |
| Exact Mass | 343.14200 |
| PSA | 65.07000 |
| LogP | 2.23690 |
| Index of Refraction | 1.612 |
| InChIKey | LZYFJRBYPJEINJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)C(=O)C1=C2CCCN2CCc2cc3c(cc21)OCO3 |
|
~%
2-acetoxy-1-(5,... CAS#:38848-22-5 |
| Literature: Weinreb; Auerbach Journal of the American Chemical Society, 1975 , vol. 97, # 9 p. 2503 - 2506 |
|
~%
2-acetoxy-1-(5,... CAS#:38848-22-5 |
| Literature: Weinreb; Auerbach Journal of the American Chemical Society, 1975 , vol. 97, # 9 p. 2503 - 2506 |
|
~%
2-acetoxy-1-(5,... CAS#:38848-22-5 |
| Literature: Weinreb; Auerbach Journal of the American Chemical Society, 1975 , vol. 97, # 9 p. 2503 - 2506 |