1-(4-Chlorophenyl)piperazine dihydrochloride structure
|
Common Name | 1-(4-Chlorophenyl)piperazine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 38869-46-4 | Molecular Weight | 269.599 | |
| Density | N/A | Boiling Point | 394.8ºC at 760 mmHg | |
| Molecular Formula | C10H15Cl3N2 | Melting Point | 275-278 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 192.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-Chlorophenyl)piperazine dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 394.8ºC at 760 mmHg |
|---|---|
| Melting Point | 275-278 °C (dec.)(lit.) |
| Molecular Formula | C10H15Cl3N2 |
| Molecular Weight | 269.599 |
| Flash Point | 192.6ºC |
| Exact Mass | 268.030090 |
| PSA | 15.27000 |
| LogP | 3.74740 |
| InChIKey | ORKOLISAYPZGHP-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Clc1ccc(N2CCNCC2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Chlorophenyl)piperazine dihydrochloride |
| 1-(4-chlorophenyl)piperazine,dihydrochloride |
| MFCD00012766 |
| 1-(4-chlorophenyl)-piperazine dihydrochloride |
| EINECS 254-165-0 |
| Piperazine, 1-(4-chlorophenyl)-, hydrochloride (1:2) |