2,4-Dichloro-3-nitrophenol structure
|
Common Name | 2,4-Dichloro-3-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 38902-87-3 | Molecular Weight | 207.999 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 314.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Cl2NO3 | Melting Point | 81-82°C | |
| MSDS | N/A | Flash Point | 144.0±27.9 °C | |
| Name | 2,4-Dichloro-3-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.5±42.0 °C at 760 mmHg |
| Melting Point | 81-82°C |
| Molecular Formula | C6H3Cl2NO3 |
| Molecular Weight | 207.999 |
| Flash Point | 144.0±27.9 °C |
| Exact Mass | 206.949005 |
| PSA | 66.05000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | GLNRZGZHZYONRE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)ccc(O)c1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
|
~%
2,4-Dichloro-3-... CAS#:38902-87-3 |
| Literature: Henley; Turner Journal of the Chemical Society, 1930 , p. 928,933 |
|
~%
2,4-Dichloro-3-... CAS#:38902-87-3 |
| Literature: Henley; Turner Journal of the Chemical Society, 1930 , p. 928,933 |
|
~%
2,4-Dichloro-3-... CAS#:38902-87-3 |
| Literature: Groves; Turner; Sharp Journal of the Chemical Society, 1929 , p. 521 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,4-Dichloro-3-nitrophenol |
| 2,4-Dichlor-3-nitro-phenol |
| 3-nitro-2,4-dichlorophenol |
| 2,4-bis(chloranyl)-3-nitro-phenol |
| 2,4-dichloro-3-nitro-phenol |
| Phenol, 2,4-dichloro-3-nitro- |
| Phenol,2,4-dichloro-3-nitro |
| 2,6-Dichloro-3-hydroxynitrobenzene |
| 2,4'-DIHYDROXYDIPHENYL SULFONE |
| 2.4-Dichlor-3-nitro-1-hydroxy-benzol |
| MFCD08059572 |