2,7-dibromo-10H-anthracen-9-one structure
|
Common Name | 2,7-dibromo-10H-anthracen-9-one | ||
|---|---|---|---|---|
| CAS Number | 38917-92-9 | Molecular Weight | 352.02100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,7-dibromo-10H-anthracen-9-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8Br2O |
|---|---|
| Molecular Weight | 352.02100 |
| Exact Mass | 349.89400 |
| PSA | 17.07000 |
| LogP | 4.34680 |
| InChIKey | HXSYTQDSHGNXHI-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(Br)ccc2Cc2ccc(Br)cc21 |
|
~%
2,7-dibromo-10H... CAS#:38917-92-9 |
| Literature: Traxler; Lira; Huffman Journal of medicinal chemistry, 1972 , vol. 15, # 8 p. 861 - 863 |
|
~%
2,7-dibromo-10H... CAS#:38917-92-9 |
| Literature: Porzi,G.; Concilio,C. Journal of Organometallic Chemistry, 1977 , vol. 128, p. 95 - 98 |
|
~%
2,7-dibromo-10H... CAS#:38917-92-9 |
| Literature: Porzi,G.; Concilio,C. Journal of Organometallic Chemistry, 1977 , vol. 128, p. 95 - 98 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,7-Dibrom-9-anthron |
| 9(10H)-Anthracenone,2,7-dibromo |
| Dibromanthron |