2,3-dihydroxy-10H-anthracen-9-one structure
|
Common Name | 2,3-dihydroxy-10H-anthracen-9-one | ||
|---|---|---|---|---|
| CAS Number | 64817-80-7 | Molecular Weight | 226.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dihydroxy-10H-anthracen-9-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10O3 |
|---|---|
| Molecular Weight | 226.22700 |
| Exact Mass | 226.06300 |
| PSA | 57.53000 |
| LogP | 2.23300 |
| InChIKey | RLYVBWVCAQEQFE-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2Cc2cc(O)c(O)cc21 |
|
~%
2,3-dihydroxy-1... CAS#:64817-80-7 |
| Literature: Green Journal of the Chemical Society, 1927 , p. 556 |
|
~%
2,3-dihydroxy-1... CAS#:64817-80-7 |
| Literature: Attree; Perkin Journal of the Chemical Society, 1931 , p. 144,152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-dihydroxy-anthrone |