9-methyl-3-(morpholin-4-ylmethyl)-2,3-dihydro-1H-carbazol-4-one structure
|
Common Name | 9-methyl-3-(morpholin-4-ylmethyl)-2,3-dihydro-1H-carbazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 38942-83-5 | Molecular Weight | 298.37900 | |
| Density | 1.28g/cm3 | Boiling Point | 487ºC at 760 mmHg | |
| Molecular Formula | C18H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.3ºC | |
| Name | 9-methyl-3-(morpholin-4-ylmethyl)-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 487ºC at 760 mmHg |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.37900 |
| Flash Point | 248.3ºC |
| Exact Mass | 298.16800 |
| PSA | 34.47000 |
| LogP | 2.19350 |
| Index of Refraction | 1.653 |
| InChIKey | YDWKRSVMKLPHPX-UHFFFAOYSA-N |
| SMILES | Cn1c2c(c3ccccc31)C(=O)C(CN1CCOCC1)CC2 |
|
~%
9-methyl-3-(mor... CAS#:38942-83-5 |
| Literature: Littell,R. et al. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 875 - 876 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4(1H)-CARBAZOLONE,2,3-DIHYDRO-9-METHYL-3-(MORPHOLINOMETHYL) |
| 2,3-Dihydro-9-methyl-3-(morpholinomethyl)-4(1H)-carbazolone |
| 9-Methyl-3-(morpholinomethyl)-2,3-dihydro-4(1H)-carbazolone |
| 9-methyl-3-morpholin-4-ylmethyl-1,2,3,9-tetrahydro-carbazol-4-one |