[2-ethyl-2-(propanoyloxymethyl)hexyl] propanoate structure
|
Common Name | [2-ethyl-2-(propanoyloxymethyl)hexyl] propanoate | ||
|---|---|---|---|---|
| CAS Number | 3895-21-4 | Molecular Weight | 272.38000 | |
| Density | 0.961g/cm3 | Boiling Point | 341.6ºC at 760 mmHg | |
| Molecular Formula | C15H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | [2-ethyl-2-(propanoyloxymethyl)hexyl] propanoate |
|---|
| Density | 0.961g/cm3 |
|---|---|
| Boiling Point | 341.6ºC at 760 mmHg |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38000 |
| Flash Point | 158ºC |
| Exact Mass | 272.19900 |
| PSA | 52.60000 |
| LogP | 3.47940 |
| Index of Refraction | 1.442 |
| InChIKey | UMKDVYFAESXPHY-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)(COC(=O)CC)COC(=O)CC |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |