2-Ethyl-2-hexylmalonic acid structure
|
Common Name | 2-Ethyl-2-hexylmalonic acid | ||
|---|---|---|---|---|
| CAS Number | 4473-04-5 | Molecular Weight | 216.27400 | |
| Density | 1.084g/cm3 | Boiling Point | 370.6ºC at 760 mmHg | |
| Molecular Formula | C11H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | 2-ethyl-2-hexylpropanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 370.6ºC at 760 mmHg |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.27400 |
| Flash Point | 192.1ºC |
| Exact Mass | 216.13600 |
| PSA | 74.60000 |
| LogP | 2.52240 |
| Index of Refraction | 1.474 |
| InChIKey | ZFUULEVFTWFFKQ-UHFFFAOYSA-N |
| SMILES | CCCCCCC(CC)(C(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
2-Ethyl-2-hexyl... CAS#:4473-04-5 |
| Literature: Dox Journal of the American Chemical Society, 1924 , vol. 46, p. 1709 |
|
~%
2-Ethyl-2-hexyl... CAS#:4473-04-5 |
| Literature: Dox Journal of the American Chemical Society, 1924 , vol. 46, p. 1709 |
|
~%
2-Ethyl-2-hexyl... CAS#:4473-04-5 |
| Literature: Dox Journal of the American Chemical Society, 1924 , vol. 46, p. 1709 |
|
~%
2-Ethyl-2-hexyl... CAS#:4473-04-5 |
| Literature: Dox Journal of the American Chemical Society, 1924 , vol. 46, p. 1709 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ethyl-hexyl-malonic acid |
| Ethyl-hexyl-malonsaeure |
| Aethyl-hexyl-malonsaeure |
| ethyl(hexyl)propanedioic acid |
| 2-Ethyl-2-hexylmalonic acid |