1,8-dihydroxy-2,5-dinitroanthraquinone structure
|
Common Name | 1,8-dihydroxy-2,5-dinitroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 39003-36-6 | Molecular Weight | 330.20600 | |
| Density | 1.838g/cm3 | Boiling Point | 606.1ºC at 760mmHg | |
| Molecular Formula | C14H6N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4ºC | |
| Name | 1,8-dihydroxy-2,5-dinitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.838g/cm3 |
|---|---|
| Boiling Point | 606.1ºC at 760mmHg |
| Molecular Formula | C14H6N2O8 |
| Molecular Weight | 330.20600 |
| Flash Point | 255.4ºC |
| Exact Mass | 330.01200 |
| PSA | 166.24000 |
| LogP | 2.73600 |
| Index of Refraction | 1.782 |
| InChIKey | WZFXDVLVEULHSB-UHFFFAOYSA-N |
| SMILES | O=C1c2c(ccc([N+](=O)[O-])c2O)C(=O)c2c([N+](=O)[O-])ccc(O)c21 |
| HS Code | 2914700090 |
|---|
|
~0%
1,8-dihydroxy-2... CAS#:39003-36-6 |
| Literature: Chang Synthetic Communications, 1994 , vol. 24, # 7 p. 931 - 937 |
|
~%
1,8-dihydroxy-2... CAS#:39003-36-6 |
| Literature: Antonello; Uriarte; Palumbo Archiv der Pharmazie, 1989 , vol. 322, # 9 p. 541 - 544 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,5-Dinitro-1,8-dihydroxy-anthraquinone |
| 9,10-Anthracenedione,1,8-dihydroxy-2,5-dinitro |
| 1,8-Dihydroxy-2,5-dinitro-9,10-anthracenedione |
| 1,8-Dihydroxy-2,5-dinitroanthraquinone |
| EINECS 254-245-5 |