2-methyl-3-nitrobenzoyl chloride structure
|
Common Name | 2-methyl-3-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 39053-41-3 | Molecular Weight | 199.59100 | |
| Density | 1.386g/cm3 | Boiling Point | 286.7ºC at 760 mmHg | |
| Molecular Formula | C8H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.2ºC | |
| Name | 2-methyl-3-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 286.7ºC at 760 mmHg |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59100 |
| Flash Point | 127.2ºC |
| Exact Mass | 199.00400 |
| PSA | 62.89000 |
| LogP | 2.80540 |
| Index of Refraction | 1.579 |
| InChIKey | UENLNPJRTOHQIC-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)Cl)cccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~95%
2-methyl-3-nitr... CAS#:39053-41-3 |
| Literature: Leze, Marie-Pierre; Palusczak, Anja; Hartmann, Rolf W.; Le Borgne, Marc Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 16 p. 4713 - 4715 |
|
~%
2-methyl-3-nitr... CAS#:39053-41-3 |
| Literature: Sorkin; Kraehenbuehl; Erlenmeyer Helvetica Chimica Acta, 1948 , vol. 31, p. 65,74 |
|
~%
2-methyl-3-nitr... CAS#:39053-41-3 |
| Literature: van Scherpenzeel Recueil des Travaux Chimiques des Pays-Bas, 1901 , vol. 20, p. 169 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-methyl-3-nitro-benzoyl chloride |
| 2-methyl-3-nitrobenzoic acid chloride |
| 3-nitro-2-methyl-benzoylchloride |
| 3-nitro-2-methylbenzoic acid chloride |
| 2-Methyl-3-nitro-benzoylchlorid |