2-Methyl-3-nitrobenzyl alcohol structure
|
Common Name | 2-Methyl-3-nitrobenzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 23876-13-3 | Molecular Weight | 167.16200 | |
| Density | 1.272 g/cm3 | Boiling Point | 323.2ºC at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 69-73 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 145.5ºC | |
| Name | 2-Methyl-3-nitrobenzyl alcohol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272 g/cm3 |
|---|---|
| Boiling Point | 323.2ºC at 760 mmHg |
| Melting Point | 69-73 °C(lit.) |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16200 |
| Flash Point | 145.5ºC |
| Exact Mass | 167.05800 |
| PSA | 66.05000 |
| LogP | 1.91870 |
| Vapour Pressure | 0.000109mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | QJANIQCEDPJNLO-UHFFFAOYSA-N |
| SMILES | Cc1c(CO)cccc1[N+](=O)[O-] |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
|
Construction of macrocyclic thiodepsipeptides: synthesis of a nosiheptide 'southern hemisphere' model system.
Chem. Commun. (Camb.) (5) , 591-3, (2008) A 20-membered macrocyclic thiodepsipeptide has been synthesized as a model for the southern hemisphere of nosiheptide, the key steps being assembly of an acyclic precursor by amide coupling of indole ... |
|
|
Oxidation and Claisen condensation products of 3-nitro-o-xylene. Askam V and Deeks RHL.
J. Chem. Soc. Sect. C 14 , 1935-36, (1969)
|
| 3-Nitro-2-methyl-1-hydroxymethyl-benzol |
| 3-nitro-2-methylbenzyl alcohol |
| 2-Methyl-3-Nitrobenzyl |
| 2-methyl-3-nitro-benzyl alcohol |
| 2-Methyl-3-nitrobenzylalcohol |
| Benzenemethanol,2-methyl-3-nitro |
| Einecs 245-923-1 |
| 2-methyl-3-nitrobenzenemethanol |
| MFCD00007166 |