Cyclohexanebutanoicacid, nickel(2+) salt (2:1)
Modify Date: 2025-08-26 17:17:40
Cyclohexanebutanoicacid, nickel(2+) salt (2:1) structure
|
Common Name | Cyclohexanebutanoicacid, nickel(2+) salt (2:1) | ||
|---|---|---|---|---|
| CAS Number | 3906-55-6 | Molecular Weight | 228.94200 | |
| Density | 0.991 g/cm3 | Boiling Point | 283.3ºCat 760 mmHg | |
| Molecular Formula | C10H18NiO2 | Melting Point | 240ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 138.9ºC | |
| Symbol |
GHS08, GHS09 |
Signal Word | Danger | |
| Name | 4-cyclohexylbutanoate,nickel(2+) |
|---|---|
| Synonym | More Synonyms |
| Density | 0.991 g/cm3 |
|---|---|
| Boiling Point | 283.3ºCat 760 mmHg |
| Melting Point | 240ºC(lit.) |
| Molecular Formula | C10H18NiO2 |
| Molecular Weight | 228.94200 |
| Flash Point | 138.9ºC |
| Exact Mass | 228.06600 |
| PSA | 37.30000 |
| LogP | 2.82160 |
| InChIKey | LSLSVVJPMABPLC-UHFFFAOYSA-L |
| SMILES | O=C([O-])CCCC1CCCCC1.O=C([O-])CCCC1CCCCC1.[Ni+2] |
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H334-H341-H350i-H360D-H372-H410 |
| Precautionary Statements | P201-P261-P273-P280-P284-P304 + P340 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R45 |
| Safety Phrases | 53-1/2-22-36/37/39-45 |
| RIDADR | UN 3077 9 / PGIII |
|
Metabolism of cyclohexaneacetic acid and cyclohexanebutyric acid by Arthrobacter sp. strain CA1.
J. Bacteriol. 150(3) , 1172-82, (1982) A strain of Arthrobacter was isolated by enrichment culture with cyclohexaneacetate as the sole source of carbon and grew with a doubling time of 4.2 h. In addition to growing with cyclohexaneacetate,... |
|
|
Naphthenic acid biodegradation by the unicellular alga Dunaliella tertiolecta.
Chemosphere 84(4) , 504-11, (2011) Naphthenic acids (NAs) are a major contributor to toxicity in tailings waste generated from bitumen production in the Athabasca Oil Sands region. While investigations have shown that bacteria can biod... |
| Nickel 4-cyclohexylbutyrate |
| Cyclohexanebutyric acid,nickel salt |
| Nickel cyclohexanebutyrate |
| Nickel cyclohexylbutyrate |
| EINECS 223-463-2 |
| MFCD00036402 |