ethyl 3-methyl-2-nitro-imidazole-4-carboxylate structure
|
Common Name | ethyl 3-methyl-2-nitro-imidazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 39070-13-8 | Molecular Weight | 199.16400 | |
| Density | 1.42g/cm3 | Boiling Point | 379.2ºC at 760 mmHg | |
| Molecular Formula | C7H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.1ºC | |
| Name | ethyl 3-methyl-2-nitroimidazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 379.2ºC at 760 mmHg |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.16400 |
| Flash Point | 183.1ºC |
| Exact Mass | 199.05900 |
| PSA | 89.94000 |
| LogP | 1.02820 |
| Index of Refraction | 1.584 |
| InChIKey | VRARWXJAWCRJCX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc([N+](=O)[O-])n1C |
| HS Code | 2933290090 |
|---|
|
~60%
ethyl 3-methyl-... CAS#:39070-13-8 |
| Literature: THRESHOLD PHARMACEUTICALS, INC. Patent: WO2007/2931 A2, 2007 ; Location in patent: Page/Page column 141-142 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-carbethoxy-1-methyl-2-nitroimidazole |
| ETHYL 3-METHYL-2-NITRO-3H-IMIDAZOLE-4-CARBOXYLATE |
| 1-N-methyl-2-nitroimidazole-5-carboxylic acid ethyl ester |
| 5-Carbethoxy-1-methyl-2-nitro-imidazol |
| 3-methyl-2-nitro-3H-imidazole-4-carboxylic acid ethyl ester |
| 1-Methyl-2-nitro-5-carbethoxy-imidazol |
| 1-methyl-2-nitro-1H-imidazole-5-carboxylate |