ethyl 3-methyl-5-nitro-imidazole-4-carboxylate structure
|
Common Name | ethyl 3-methyl-5-nitro-imidazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 70183-93-6 | Molecular Weight | 199.16400 | |
| Density | 1.42g/cm3 | Boiling Point | 375.4ºC at 760 mmHg | |
| Molecular Formula | C7H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.9ºC | |
| Name | ethyl 3-methyl-5-nitroimidazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 375.4ºC at 760 mmHg |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.16400 |
| Flash Point | 180.9ºC |
| Exact Mass | 199.05900 |
| PSA | 89.94000 |
| LogP | 1.02820 |
| Index of Refraction | 1.584 |
| InChIKey | RZGNXWVBVNTXKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c([N+](=O)[O-])ncn1C |
|
~%
ethyl 3-methyl-... CAS#:70183-93-6 |
| Literature: Mann; Porter Journal of the Chemical Society, 1945 , p. 751,757 |
|
~%
ethyl 3-methyl-... CAS#:70183-93-6 |
| Literature: Mann; Porter Journal of the Chemical Society, 1945 , p. 751,757 |
|
~%
ethyl 3-methyl-... CAS#:70183-93-6 |
| Literature: Mann; Porter Journal of the Chemical Society, 1945 , p. 751,757 |
| 3-methyl-5-nitro-3H-imidazole-4-carboxylic acid ethyl ester |
| 3-Methyl-5-nitro-3H-imidazol-4-carbonsaeure-aethylester |