UCM 707 structure
|
Common Name | UCM 707 | ||
|---|---|---|---|---|
| CAS Number | 390824-20-1 | Molecular Weight | 383.567 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 538.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H37NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.7±30.1 °C | |
Use of UCM 707UCM707, a potent and selective inhibitor of endocannabinoid uptake, potentiates hypokinetic and antinociceptive effects of Anandamide[1]. |
| Name | N-(furan-3-ylmethyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Description | UCM707, a potent and selective inhibitor of endocannabinoid uptake, potentiates hypokinetic and antinociceptive effects of Anandamide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 538.9±50.0 °C at 760 mmHg |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.567 |
| Flash Point | 279.7±30.1 °C |
| Exact Mass | 383.282440 |
| PSA | 42.24000 |
| LogP | 7.19 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | FZNNBSHTNRBBBD-DOFZRALJSA-N |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCc1ccoc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5,8,11,14-Eicosatetraenamide, N-(3-furanylmethyl)-, (5Z,8Z,11Z,14Z)- |
| ucm 707 |
| (5Z,8Z,11Z,14Z)-N-(furan-3-ylmethyl)icosa-5,8,11,14-tetraenamide |
| (5Z,8Z,11Z,14Z)-N-(3-Furylmethyl)-5,8,11,14-icosatetraenamide |