Arachidonic acid structure
|
Common Name | Arachidonic acid | ||
|---|---|---|---|---|
| CAS Number | 506-32-1 | Molecular Weight | 304.467 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 407.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O2 | Melting Point | −49 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 336.3±18.0 °C | |
Use of Arachidonic acidArachidonic acid is an essential fatty acid and a major constituent of biomembranes. |
| Name | arachidonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Arachidonic acid is an essential fatty acid and a major constituent of biomembranes. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vivo | Arachidonic acid (ARA) is converted into various lipid mediators, such as prostaglandin E2 (PGE2), which is involved in the development of rheumatoid arthritis (RA)[1]. |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.5±0.0 °C at 760 mmHg |
| Melting Point | −49 °C(lit.) |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.467 |
| Flash Point | 336.3±18.0 °C |
| Exact Mass | 304.240234 |
| PSA | 37.30000 |
| LogP | 6.91 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | YZXBAPSDXZZRGB-DOFZRALJSA-N |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)O |
| Water Solubility | PRACTICALLY INSOLUBLE |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | F |
| Risk Phrases | R19 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CE6675000 |
| Packaging Group | I; II; III |
| Hazard Class | 6.1 |
| HS Code | 2916190090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Omega-3 fatty acids, EPA and DHA induce apoptosis and enhance drug sensitivity in multiple myeloma cells but not in normal peripheral mononuclear cells.
J. Nutr. Biochem. 25(12) , 1254-62, (2014) The n-3 polyunsaturated fatty acids eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA) have been shown to enhance the effect of chemotherapeutic drugs in clinical studies in cancer patients an... |
|
|
Cryopreservation prevents iron-initiated highly unsaturated fatty acid loss during storage of human blood on chromatography paper at -20°C.
J. Nutr. 145(3) , 654-60, (2015) Fingertip prick whole blood collection on chromatography paper is amenable to high-throughput fatty acid (FA) profiling for large clinical and field studies. However, sample storage is problematic bec... |
|
|
Reduced filaggrin expression is accompanied by increased Staphylococcus aureus colonization of epidermal skin models.
Clin. Exp. Allergy 44(12) , 1515-24, (2014) Atopic dermatitis is an inflammatory skin disease that is characterized by a reduced skin barrier function, reduced filaggrin (FLG) expression as well as increased colonization by Staphylococcus aureu... |
| (5Z,8Z,11Z,14Z)-Icosa-5,8,11,14-tetraenoic acid |
| AA |
| Immunocytophyte |
| eicosatetraenoic acid |
| MFCD00004417 |
| PUFA 20:4n-6 |
| ARACHIDONIC ACID(RG) |
| 5,8,11,14-Icosatetraenoic Acid |
| Arachidonic acid |
| Hydrazinecarboselenoamide |
| ARA |
| 5,8,11,14-Eicosatetraenoic Acid |
| (5Z,8Z,11Z,14Z)-5,8,11,14-Icosatetraenoic acid |
| C20:4 (cis-5,8,11,14) |
| 20:4n-6 |
| 5,8,11,14-all-cis-Eicosatetraenoic acid |
| 5,8,11,14-Eicosatetraenoic acid, (all-Z)- |
| 5,8,11,14-Eicosatetraenoic acid, (5Z,8Z,11Z,14Z)- |
| Arachidonate |
| (5Z,8Z,11Z,14Z)-5,8,11,14-Eicosatetraenoic acid |
| Arachidonic |
| EINECS 208-033-4 |
| (all-Z)-5,8,11,14-Eicosatetraenoic acid |