N-benzyl-2,2-dichloro-N-ethylacetamide structure
|
Common Name | N-benzyl-2,2-dichloro-N-ethylacetamide | ||
|---|---|---|---|---|
| CAS Number | 39084-68-9 | Molecular Weight | 246.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-2,2-dichloro-N-ethylacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13Cl2NO |
|---|---|
| Molecular Weight | 246.13300 |
| Exact Mass | 245.03700 |
| PSA | 20.31000 |
| LogP | 2.83880 |
| InChIKey | YRZIQWSPMZZTOS-UHFFFAOYSA-N |
| SMILES | CCN(Cc1ccccc1)C(=O)C(Cl)Cl |
|
~%
N-benzyl-2,2-di... CAS#:39084-68-9 |
| Literature: Surrey; Rukwid Journal of the American Chemical Society, 1955 , vol. 77, p. 3798,3800 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acetamide,2,2-dichloro-N-ethyl-N-(phenylmethyl) |
| dichloro-acetic acid-(ethyl-benzyl-amide) |
| Dichlor-essigsaeure-(aethyl-benzyl-amid) |