2,2-dichloro-N-ethyl-N-phenyl-acetamide structure
|
Common Name | 2,2-dichloro-N-ethyl-N-phenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 39084-75-8 | Molecular Weight | 232.10600 | |
| Density | 1.284g/cm3 | Boiling Point | 290.9ºC at 760 mmHg | |
| Molecular Formula | C10H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.8ºC | |
| Name | 2,2-dichloro-N-ethyl-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 290.9ºC at 760 mmHg |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.10600 |
| Flash Point | 129.8ºC |
| Exact Mass | 231.02200 |
| PSA | 20.31000 |
| LogP | 2.84320 |
| Index of Refraction | 1.572 |
| InChIKey | UMXIXMCDRVTRDS-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)C(Cl)Cl)c1ccccc1 |
|
~%
2,2-dichloro-N-... CAS#:39084-75-8 |
| Literature: McKie Journal of the Chemical Society, 1923 , vol. 123, p. 2215 Journal of the Chemical Society, 1924 , vol. 125, p. 1077 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dichloro-acetic acid-(N-ethyl-anilide) |
| N-ethyl-N-phenyl-2,2-dichloroacetamide |
| Dichlor-essigsaeure-(N-aethyl-anilid) |