N-(benzenesulfonyl)-N-phenyl-acetamide structure
|
Common Name | N-(benzenesulfonyl)-N-phenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 39096-02-1 | Molecular Weight | 275.32300 | |
| Density | 1.306g/cm3 | Boiling Point | 422.1ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | (4-chlorophenyl)silicon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 422.1ºC at 760 mmHg |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.32300 |
| Flash Point | 209.1ºC |
| Exact Mass | 275.06200 |
| PSA | 62.83000 |
| LogP | 3.50920 |
| Index of Refraction | 1.615 |
| InChIKey | PXSATHWJWSKAAJ-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccccc1)S(=O)(=O)c1ccccc1 |
|
~%
N-(benzenesulfo... CAS#:39096-02-1 |
| Literature: Wheeler; Smith; Warren American Chemical Journal, 1897 , vol. 19, p. 760,764 |
|
~%
N-(benzenesulfo... CAS#:39096-02-1 |
| Literature: Kurzer Journal of the Chemical Society, 1949 , p. 3029,3030 |
|
~%
N-(benzenesulfo... CAS#:39096-02-1 |
| Literature: Oxley; Short Journal of the Chemical Society, 1947 , p. 382,389 |
| N-Acetyl-benzolsulfanilid |
| EINECS 223-073-2 |
| N-benzenesulfonyl-acetanilide |
| N-Benzolsulfonyl-acetanilid |
| Benzene,1-chloro-4-silyl |
| N-Benzolsulfonyl-N-acetyl-anilin |