2-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]isoindole-1,3-dione structure
|
Common Name | 2-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 391-10-6 | Molecular Weight | 333.26100 | |
| Density | 1.429g/cm3 | Boiling Point | 460.5ºC at 760 mmHg | |
| Molecular Formula | C17H10F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.3ºC | |
| Name | 2-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 460.5ºC at 760 mmHg |
| Molecular Formula | C17H10F3NO3 |
| Molecular Weight | 333.26100 |
| Flash Point | 232.3ºC |
| Exact Mass | 333.06100 |
| PSA | 54.45000 |
| LogP | 3.12220 |
| Index of Refraction | 1.574 |
| InChIKey | YCTRFLJIVGYLTG-UHFFFAOYSA-N |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)c1ccc(C(F)(F)F)cc1 |
|
~%
2-[2-oxo-2-[4-(... CAS#:391-10-6 |
| Literature: Caldwell; Schweiker Journal of the American Chemical Society, 1953 , vol. 75, p. 5884,5886 |
|
~%
2-[2-oxo-2-[4-(... CAS#:391-10-6 |
| Literature: Caldwell; Schweiker Journal of the American Chemical Society, 1953 , vol. 75, p. 5884,5886 |
|
~%
2-[2-oxo-2-[4-(... CAS#:391-10-6 |
| Literature: Temple, Carroll; Wheeler, Glynn P.; Elliott, Robert D.; Rose, Jerry D.; Kussner, Conrad L.; et al. Journal of Medicinal Chemistry, 1982 , vol. 25, # 9 p. 1045 - 1050 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(4-Trifluormethyl-phenacyl)-phthalimid |
| N-(4-trifluoromethyl-phenacyl)-phthalimide |
| HMS1526I09 |