2-Chloro-N-(2,4,6-trimethyl-phenyl)-acetamide structure
|
Common Name | 2-Chloro-N-(2,4,6-trimethyl-phenyl)-acetamide | ||
|---|---|---|---|---|
| CAS Number | 3910-51-8 | Molecular Weight | 211.68800 | |
| Density | 1.158g/cm3 | Boiling Point | 324.1ºC at 760 mmHg | |
| Molecular Formula | C11H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.8ºC | |
| Name | 2-Chloro-N-(2,4,6-trimethyl-phenyl)-acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 324.1ºC at 760 mmHg |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.68800 |
| Flash Point | 149.8ºC |
| Exact Mass | 211.07600 |
| PSA | 29.10000 |
| LogP | 2.86210 |
| Index of Refraction | 1.568 |
| InChIKey | YQYQXBOOGVRRKI-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(NC(=O)CCl)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-CHLORO-2',4',6'-TRIMETHYLACETANILIDE |
| 2-CHLORO-N-(2,4,6-TRIMETHYL-PHENYL)-ACETAMIDE |
| 2-chloro-N-(2,4,6-trimethylphenyl)acetamide |