2-Chloro-N-(2,4,6-tribromophenyl)acetamide structure
|
Common Name | 2-Chloro-N-(2,4,6-tribromophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 89892-46-6 | Molecular Weight | 406.29600 | |
| Density | 2.226g/cm3 | Boiling Point | 442.6ºC at 760 mmHg | |
| Molecular Formula | C8H5Br3ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.5ºC | |
| Name | 2-Chloro-N-(2,4,6-tribromophenyl)acetamide |
|---|
| Density | 2.226g/cm3 |
|---|---|
| Boiling Point | 442.6ºC at 760 mmHg |
| Molecular Formula | C8H5Br3ClNO |
| Molecular Weight | 406.29600 |
| Flash Point | 221.5ºC |
| Exact Mass | 402.76100 |
| PSA | 32.59000 |
| LogP | 4.80090 |
| Index of Refraction | 1.673 |
| InChIKey | SDQSCWQZOOIZAF-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1c(Br)cc(Br)cc1Br |
| HS Code | 2924299090 |
|---|
|
~82%
2-Chloro-N-(2,4... CAS#:89892-46-6 |
| Literature: Pace, Vittorio; Castoldi, Laura; Holzer, Wolfgang Chemical Communications, 2013 , vol. 49, # 75 p. 8383 - 8385 |
|
~82%
2-Chloro-N-(2,4... CAS#:89892-46-6 |
| Literature: Stankovsky, Stefan; Jedlovska, Eva; Spirkova, Katarina Collection of Czechoslovak Chemical Communications, 1993 , vol. 58, # 9 p. 2211 - 2214 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |