2-(hydroxymethyl)-5-[2-[(4-nitrophenyl)methylselanyl]-3,5,8,9-tetrazabicyclo[4.3.0]nona-2,4,6,9-tetraen-7-yl]oxolane-3,4-diol structure
|
Common Name | 2-(hydroxymethyl)-5-[2-[(4-nitrophenyl)methylselanyl]-3,5,8,9-tetrazabicyclo[4.3.0]nona-2,4,6,9-tetraen-7-yl]oxolane-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 39102-68-6 | Molecular Weight | 466.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N5O6Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(hydroxymethyl)-5-[7-[(4-nitrophenyl)methylselanyl]-2H-pyrazolo[4,3-d]pyrimidin-3-yl]oxolane-3,4-diol |
|---|
| Molecular Formula | C17H17N5O6Se |
|---|---|
| Molecular Weight | 466.30700 |
| Exact Mass | 467.03400 |
| PSA | 170.20000 |
| InChIKey | ZOULKAFRXVCKDP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C[Se]c2ncnc3c(C4OC(CO)C(O)C4O)[nH]nc23)cc1 |
|
~%
2-(hydroxymethy... CAS#:39102-68-6 |
| Literature: Milne,G.H.; Townsend,L.B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 2677 - 2681 |
|
~%
2-(hydroxymethy... CAS#:39102-68-6 |
| Literature: Milne,G.H.; Townsend,L.B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 2677 - 2681 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |