PD318088
Modify Date: 2025-12-04 17:02:19
PD318088 structure
|
Common Name | PD318088 | ||
|---|---|---|---|---|
| CAS Number | 391210-00-7 | Molecular Weight | 561.089 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H13BrF3IN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PD318088PD318088 is an allosteric MEK inhibitor. |
| Name | 5-bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | PD318088 is an allosteric MEK inhibitor. |
|---|---|
| Related Catalog | |
| Target |
MEK |
| References |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H13BrF3IN2O4 |
| Molecular Weight | 561.089 |
| Exact Mass | 559.905518 |
| PSA | 94.31000 |
| LogP | 7.43 |
| Index of Refraction | 1.660 |
| InChIKey | XXSSGBYXSKOLAM-UHFFFAOYSA-N |
| SMILES | O=C(NOCC(O)CO)c1cc(Br)c(F)c(F)c1Nc1ccc(I)cc1F |
| Storage condition | -20℃ |
| cc-457 |
| C16H13BrF3IN2O4 |
| 5-Bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzamide |
| S1568_Selleck |
| Benzamide, 5-bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]- |
| PD318088 |