(all-trans)-retinaldehyde, compound with hydroquinone (1:1) structure
|
Common Name | (all-trans)-retinaldehyde, compound with hydroquinone (1:1) | ||
|---|---|---|---|---|
| CAS Number | 3915-70-6 | Molecular Weight | 394.54600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzene-1,4-diol,3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H34O3 |
|---|---|
| Molecular Weight | 394.54600 |
| Exact Mass | 394.25100 |
| PSA | 57.53000 |
| LogP | 6.81470 |
| InChIKey | ZHKGDWZRSKMEEM-FUTAMACOSA-N |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CC=O.Oc1ccc(O)cc1 |
| benzene-1,4-diol |