Methyl perfluoro-3,6-dioxaheptanoate structure
|
Common Name | Methyl perfluoro-3,6-dioxaheptanoate | ||
|---|---|---|---|---|
| CAS Number | 39187-41-2 | Molecular Weight | 310.07100 | |
| Density | 1.606g/cm3 | Boiling Point | 160.7ºC at 760mmHg | |
| Molecular Formula | C6H3F9O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 50.2ºC | |
| Name | Methyl perfluoro-3,6-dioxaheptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.606g/cm3 |
|---|---|
| Boiling Point | 160.7ºC at 760mmHg |
| Molecular Formula | C6H3F9O4 |
| Molecular Weight | 310.07100 |
| Flash Point | 50.2ºC |
| Exact Mass | 309.98900 |
| PSA | 44.76000 |
| LogP | 2.49080 |
| Index of Refraction | 1.303 |
| InChIKey | NDRNDAZKCQFBST-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918990090 |
|
~%
Methyl perfluor... CAS#:39187-41-2 |
| Literature: 3M INNOVATIVE PROPERTIES COMPANY Patent: WO2009/42853 A2, 2009 ; Location in patent: Page/Page column 11 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetate |