oxido-(2,4,6-trimethylphenyl)-(2,4,6-trimethylphenyl)iminoazanium structure
|
Common Name | oxido-(2,4,6-trimethylphenyl)-(2,4,6-trimethylphenyl)iminoazanium | ||
|---|---|---|---|---|
| CAS Number | 39201-71-3 | Molecular Weight | 282.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | oxido-(2,4,6-trimethylphenyl)-(2,4,6-trimethylphenyl)iminoazanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H22N2O |
|---|---|
| Molecular Weight | 282.38000 |
| Exact Mass | 282.17300 |
| PSA | 41.11000 |
| LogP | 5.98590 |
| InChIKey | KPECXSXHWHXFJZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(N=[N+]([O-])c2c(C)cc(C)cc2C)c(C)c1 |
|
~15%
oxido-(2,4,6-tr... CAS#:39201-71-3 |
| Literature: Okazaki, Renji; Watanabe, Masako; Inagaki, Yoshio; Inamoto, Naoki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1365 - 1369 |
|
~%
oxido-(2,4,6-tr... CAS#:39201-71-3 |
| Literature: Bamberger Chemische Berichte, 1926 , vol. 59, p. 423 |
|
~%
oxido-(2,4,6-tr... CAS#:39201-71-3 |
| Literature: Bamberger Chemische Berichte, 1926 , vol. 59, p. 423 |
|
~%
oxido-(2,4,6-tr... CAS#:39201-71-3 |
| Literature: Bamberger Chemische Berichte, 1926 , vol. 59, p. 423 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| dimesityl-diazene-N-oxide |
| 2,2',4,4',6,6'-Hexamethylazoxy-benzol |
| 2.4.6.2'.4'.6'-Hexamethyl-azoxybenzol |
| Azoxymesitylen |
| Dimesityl-diazen-N-oxid |
| 2,2',4,4',6,6'-hexamethylazoxybenzene |
| Diazene,bis(2,4,6-trimethylphenyl)-,1-oxide |