3-Nitro-1H-pyrazole-4-carbonitrile structure
|
Common Name | 3-Nitro-1H-pyrazole-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 39205-87-3 | Molecular Weight | 138.084 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 468.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C4H2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.0±24.6 °C | |
| Name | 3-Nitro-1H-pyrazole-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 468.3±30.0 °C at 760 mmHg |
| Molecular Formula | C4H2N4O2 |
| Molecular Weight | 138.084 |
| Flash Point | 237.0±24.6 °C |
| Exact Mass | 138.017776 |
| PSA | 98.29000 |
| LogP | 0.09 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | BHWGVDFLAUBWLA-UHFFFAOYSA-N |
| SMILES | N#Cc1cn[nH]c1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
|
~89%
3-Nitro-1H-pyra... CAS#:39205-87-3 |
| Literature: Vinogradov, V. M.; Cherkasova, T. I.; Dalinger, I. L.; Shevelev, S. A. Russian Chemical Bulletin, 1993 , vol. 42, # 9 p. 1552 - 1554 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1993 , # 9 p. 1616 - 1618 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-1H-pyrazole-4-carbonitrile |
| 3-Nitro-1H-pyrazole-4-carbonitrile |