3,5-bis(trifluoromethyl)benzenesulfonamide structure
|
Common Name | 3,5-bis(trifluoromethyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 39213-22-4 | Molecular Weight | 293.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F6NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5F6NO2S |
|---|---|
| Molecular Weight | 293.18600 |
| Exact Mass | 292.99500 |
| PSA | 68.54000 |
| LogP | 4.15270 |
| InChIKey | UQRLSJLFAHCJBF-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| HS Code | 2935009090 |
|---|
|
~97%
3,5-bis(trifluo... CAS#:39213-22-4 |
| Literature: Kinsella, Michael; Duggan, Patrick G.; Muldoon, Jimmy; Eccles, Kevin S.; Lawrence, Simon E.; Lennon, Claire M. European Journal of Organic Chemistry, 2011 , # 6 p. 1125 - 1132 |
|
~%
3,5-bis(trifluo... CAS#:39213-22-4 |
| Literature: Merck and Co., Inc. Patent: US3987199 A1, 1976 ; |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 3,5-bis(trifluoromethyl)phenyl sulfonamide |
| 3,5-bis(trifluoromethyl)benzylsulfonamide |
| 3,5-bis-trifluoromethylbenzenesulfonamide |
| 3,5-ditrifluoromethylbenzenesulfonamide |
| 3,5-bis(trifluoromethyl)benzene sulphonamide |