1-(2,3-dihydroxynaphthalen-1-yl)naphthalene-2,3-diol structure
|
Common Name | 1-(2,3-dihydroxynaphthalen-1-yl)naphthalene-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 39215-21-9 | Molecular Weight | 318.32300 | |
| Density | 1.469g/cm3 | Boiling Point | 558.6ºC at 760mmHg | |
| Molecular Formula | C20H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.9ºC | |
| Name | [1,1'-Binaphthalene]-2,2',3,3'-tetrol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 558.6ºC at 760mmHg |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.32300 |
| Flash Point | 266.9ºC |
| Exact Mass | 318.08900 |
| PSA | 80.92000 |
| LogP | 4.48240 |
| InChIKey | OOSHJGKXQBJASF-UHFFFAOYSA-N |
| SMILES | Oc1cc2ccccc2c(-c2c(O)c(O)cc3ccccc23)c1O |
| HS Code | 2907299090 |
|---|
|
~87%
1-(2,3-dihydrox... CAS#:39215-21-9 |
| Literature: Toda, Fumio; Tanaka, Koichi; Iwata, Shinji Journal of Organic Chemistry, 1989 , vol. 54, # 13 p. 3007 - 3009 |
|
~84%
1-(2,3-dihydrox... CAS#:39215-21-9 |
| Literature: Zhao, Dongbing; Wu, Ningjie; Zhang, Shuai; Xi, Peihua; Su, Xiaoyu; Lan, Jingbo; You, Jingsong Angewandte Chemie - International Edition, 2009 , vol. 48, # 46 p. 8729 - 8732 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2',3,3'-Tetrahydro-3,3,3',3'-tetramethyl-1,1'-spirobi<1H-indene>-6,6'-diol |
| 6,6'-dihydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindane |
| 6,6'-dihydroxy-3,3,3',3'-tetramethyl-1,1'-spirobisindane |
| 2,3,2'3'-tetrahydroxy-1,1'binaphthyl |
| 2,2'3,3'-tetrahydroxy-1,1'-binaphthyl |
| 2,2',3,3'-tetrahydroxy-1,1'-binaphthalene |
| 3,3,3',3'-tetramethyl-1,1'-spirobisindane-6,6'-diol |
| 2,2',3,3'-tetrahydroxy-1,1'-dinaphthyl |
| 2,2,3,3-Tetrafluor-propyloxy-essigsaeure |
| rac-2,2',3,3'-tetrahydroxy-1,1'-binaphthyl |
| 6,6'-dihydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan |