N-[4-Amino-3-(trifluoromethyl)phenyl]-2-methylpropanamide structure
|
Common Name | N-[4-Amino-3-(trifluoromethyl)phenyl]-2-methylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 39235-51-3 | Molecular Weight | 246.22900 | |
| Density | 1.284g/cm3 | Boiling Point | 289.154ºC at 760 mmHg | |
| Molecular Formula | C11H13F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.676ºC | |
| Name | N-[4-Amino-3-(trifluoromethyl)phenyl]-2-methylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 289.154ºC at 760 mmHg |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.22900 |
| Flash Point | 128.676ºC |
| Exact Mass | 246.09800 |
| PSA | 58.61000 |
| LogP | 4.11280 |
| Index of Refraction | 1.527 |
| InChIKey | SAKLWQRDMOSOGQ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)Nc1ccc(N)c(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
|
~95%
N-[4-Amino-3-(t... CAS#:39235-51-3 |
| Literature: Jagadeesh, Rajenahally V.; Surkus, Annette-Enrica; Junge, Henrik; Pohl, Marga-Martina; Radnik, Joerg; Rabeah, Jabor; Huan, Heming; Schunemann, Volker; Brueckner, Angelika; Beller, Matthias Science, 2013 , vol. 342, # 6162 p. 1073 - 1076 |
|
~4%
N-[4-Amino-3-(t... CAS#:39235-51-3 |
| Literature: Herath, Wimal; Khan, Ikhlas Ahmad Chemical and Pharmaceutical Bulletin, 2010 , vol. 58, # 4 p. 562 - 564 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| |A,|A,|A-Trifluoro-4'-amino-2-methyl-m-propionotoluidide |
| 4'-amino-3'-trifluoromethylisobutyranilide |
| FLU-6 |