N,N-Dimethylcarbamic acid m-isopropylphenyl ester
Modify Date: 2025-09-26 12:42:17
N,N-Dimethylcarbamic acid m-isopropylphenyl ester structure
|
Common Name | N,N-Dimethylcarbamic acid m-isopropylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 3938-45-2 | Molecular Weight | 207.26900 | |
| Density | 1.031g/cm3 | Boiling Point | 278.8ºC at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.4ºC | |
| Name | (3-propan-2-ylphenyl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 278.8ºC at 760 mmHg |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.26900 |
| Flash Point | 122.4ºC |
| Exact Mass | 207.12600 |
| PSA | 29.54000 |
| LogP | 2.87040 |
| Index of Refraction | 1.51 |
| InChIKey | RDKXIDLUGBHOCT-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(OC(=O)N(C)C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Isopropylphenyl-N,N-dimethylcarbamat |
| N,N-Dimethylcarbamic acid,m-isopropyl phenyl ester |
| CARBAMIC ACID,N,N-DIMETHYL-,m-ISOPROPYLPHENYL ESTER |