2,4-dioxo-4-(4-piperidin-1-ylphenyl)butanoic acid structure
|
Common Name | 2,4-dioxo-4-(4-piperidin-1-ylphenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 394655-15-3 | Molecular Weight | 275.30000 | |
| Density | 1.38 g/cm3 | Boiling Point | 491.6ºC at 760 mmHg | |
| Molecular Formula | C15H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
| Name | 2,4-dioxo-4-(4-piperidin-1-ylphenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38 g/cm3 |
|---|---|
| Boiling Point | 491.6ºC at 760 mmHg |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30000 |
| Flash Point | 251.1ºC |
| Exact Mass | 275.11600 |
| PSA | 74.68000 |
| LogP | 1.96840 |
| Index of Refraction | 1.574 |
| InChIKey | MSACGCINQCCHBD-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(N2CCCCC2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-DIBROMOACETANILIDE |
| GL-0060 |
| 2,4-dioxo-4-[4-(piperidin-1-yl)phenyl]butanoic acid |