1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one
1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one structure
|
Common Name | 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 39489-71-9 | Molecular Weight | 242.76500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15ClOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15ClOS |
|---|---|
| Molecular Weight | 242.76500 |
| Exact Mass | 242.05300 |
| PSA | 42.37000 |
| LogP | 4.04730 |
| InChIKey | YAMGGOCRPIXGTG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CSc1ccc(Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:39489-86-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(p-chlorophenylthio)-3,3-dimethyl-2-butanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: InChIKey of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one is YAMGGOCRPIXGTG-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: The English name of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one is 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one. |
| Q: What English synonyms does 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one have? |
| A: English synonyms of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one: 1-(p-chlorophenylthio)-3,3-dimethyl-2-butanone. |
| Q: What is the Chinese name of 39489-71-9? |
| A: Chinese name of 39489-71-9 is 39489-71-9. |
| Q: What are the downstream products of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: Related downstream products(CAS) of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one: 39489-86-6. |
| Q: What is the molecular formula of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: Molecular formula of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one is C12H15ClOS. |
| Q: What is the molecular weight of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: Molecular weight of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one is 242.76500. |
| Q: What is the polar surface area (PSA) of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: Polar surface area (PSA) of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one is 42.37000. |
| Q: What is the SMILES notation of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: SMILES notation of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)CSc1ccc(Cl)cc1. |
| Q: What is the CAS number of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one? |
| A: CAS number of 1-(4-chlorophenylthio)-3,3-dimethylbutan-2-one is 39489-71-9. |