2-(4-FLUORO-BENZYLOXY)-BENZOIC ACID
2-(4-FLUORO-BENZYLOXY)-BENZOIC ACID structure
|
Common Name | 2-(4-FLUORO-BENZYLOXY)-BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 396-11-2 | Molecular Weight | 246.23400 | |
| Density | N/A | Boiling Point | 401.9ºC at 760mmHg | |
| Molecular Formula | C14H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-fluorophenyl)methoxy]benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 401.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H11FO3 |
| Molecular Weight | 246.23400 |
| Flash Point | 196.9ºC |
| Exact Mass | 246.06900 |
| PSA | 46.53000 |
| LogP | 3.10290 |
| InChIKey | BQYHWZTZZNBDMR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1OCc1ccc(F)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
![methyl 2-[(4-fluorophenyl)methoxy]benzoate Structure](https://image.chemsrc.com/caspic/003/851664-22-7.png)
CAS#:851664-22-7
CAS#:69-72-7
CAS#:119-36-8
CAS#:352-11-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(4-Fluor-benzyloxy)-benzoesaeure |
| 2-(2-METHOXY-ETHOXY)-PHENYLAMINE |
| F3284-8041 |
| 2-[(4-fluorobenzyl)oxy]benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: CAS number of 2-[(4-fluorophenyl)methoxy]benzoic acid is 396-11-2. |
| Q: What is the molecular formula of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: Molecular formula of 2-[(4-fluorophenyl)methoxy]benzoic acid is C14H11FO3. |
| Q: What is the SMILES notation of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: SMILES notation of 2-[(4-fluorophenyl)methoxy]benzoic acid is O=C(O)c1ccccc1OCc1ccc(F)cc1. |
| Q: What is the boiling point of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: Boiling point of 2-[(4-fluorophenyl)methoxy]benzoic acid is 401.9ºC at 760mmHg. |
| Q: What is the molecular weight of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: Molecular weight of 2-[(4-fluorophenyl)methoxy]benzoic acid is 246.23400. |
| Q: What is the English name of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: The English name of 2-[(4-fluorophenyl)methoxy]benzoic acid is 2-[(4-fluorophenyl)methoxy]benzoic acid. |
| Q: What is the InChIKey of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: InChIKey of 2-[(4-fluorophenyl)methoxy]benzoic acid is BQYHWZTZZNBDMR-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-[(4-fluorophenyl)methoxy]benzoic acid have? |
| A: English synonyms of 2-[(4-fluorophenyl)methoxy]benzoic acid: 2-(4-Fluor-benzyloxy)-benzoesaeure, 2-(2-METHOXY-ETHOXY)-PHENYLAMINE, F3284-8041, 2-[(4-fluorobenzyl)oxy]benzoic acid. |
| Q: What are the upstream materials of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: Related upstream materials(CAS) of 2-[(4-fluorophenyl)methoxy]benzoic acid: 851664-22-7;69-72-7;119-36-8;352-11-4. |
| Q: What is the polar surface area (PSA) of 2-[(4-fluorophenyl)methoxy]benzoic acid? |
| A: Polar surface area (PSA) of 2-[(4-fluorophenyl)methoxy]benzoic acid is 46.53000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |