Benzoyl chloride, 2-hydroxy-4-nitro- (9CI) structure
|
Common Name | Benzoyl chloride, 2-hydroxy-4-nitro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 39614-82-9 | Molecular Weight | 201.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-4-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4ClNO4 |
|---|---|
| Molecular Weight | 201.56400 |
| Exact Mass | 200.98300 |
| PSA | 83.12000 |
| LogP | 2.20260 |
| InChIKey | GIXCHTWQWLWUCY-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])cc1O |
| HS Code | 2918290000 |
|---|
|
~73%
Benzoyl chlorid... CAS#:39614-82-9 |
| Literature: F2G LTD Patent: WO2008/62182 A1, 2008 ; Location in patent: Page/Page column 136 ; |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Nitro-salicoylchlorid |
| 2-Hydroxy-4-nitro-benzoylchlorid |
| 2-HYDROXY-4-NITRO-BENZOYL CHLORIDE |
| Benzoyl chloride,2-hydroxy-4-nitro |
| p-Nitrosalicylsaeurechlorid |