4-Nitrosalicylic Acid structure
|
Common Name | 4-Nitrosalicylic Acid | ||
|---|---|---|---|---|
| CAS Number | 619-19-2 | Molecular Weight | 183.118 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 389.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5NO5 | Melting Point | 235-239 °C(lit.) | |
| MSDS | USA | Flash Point | 179.2±15.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitrosalicylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.0±37.0 °C at 760 mmHg |
| Melting Point | 235-239 °C(lit.) |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.118 |
| Flash Point | 179.2±15.0 °C |
| Exact Mass | 183.016769 |
| PSA | 103.35000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | UKWUOTZGXIZAJC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | VO5300100 |
| HS Code | 2918290000 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|
Novel pathway for the degradation of 2-chloro-4-nitrobenzoic acid by Acinetobacter sp. strain RKJ12.
Appl. Environ. Microbiol. 77(18) , 6606-13, (2011) The organism Acinetobacter sp. RKJ12 is capable of utilizing 2-chloro-4-nitrobenzoic acid (2C4NBA) as a sole source of carbon, nitrogen, and energy. In the degradation of 2C4NBA by strain RKJ12, vario... |
|
Name: Induction of HEK293 cell aggregation measured after 12 hrs by DAPI staining based imm...
Source: ChEMBL
Target: HEK293
External Id: CHEMBL4017620
|
|
Name: Chaperone activity at recombinant human C-terminal FLAG-tagged pendrin P123S mutant e...
Source: ChEMBL
Target: Pendrin
External Id: CHEMBL4017618
|
|
Name: Cytotoxicity against HEK293 cells harboring pendrin P123S mutant after 72 hrs by MTT ...
Source: ChEMBL
Target: HEK293
External Id: CHEMBL4017610
|
| 2-hydroxy-4-nitrobenzoic acid |
| P-NITROSALICYLIC ACID |
| EINECS 210-584-0 |
| 4-Nitro-2-hydroxybenzoic acid |
| 4-Nitrosalicylic Acid |
| MFCD00071505 |