Sodium Dimethyl 5-Sulfoisophthalate structure
|
Common Name | Sodium Dimethyl 5-Sulfoisophthalate | ||
|---|---|---|---|---|
| CAS Number | 3965-55-7 | Molecular Weight | 296.229 | |
| Density | 1.458g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NaO7S | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 138ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Sodium dimethyl 5-sulphonatoisophthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C10H9NaO7S |
| Molecular Weight | 296.229 |
| Flash Point | 138ºC |
| Exact Mass | 295.996674 |
| PSA | 118.18000 |
| LogP | 1.24470 |
| InChIKey | LLHSEQCZSNZLRI-UHFFFAOYSA-M |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)[O-])c1.[Na+] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| RTECS | DB5044550 |
|
Preparation and dispersion properties of water-soluble polyethylene glycol-dimethyl 5-sulfoisophthalate sodium salt polyester surfactants. Lin LH, et al.
Colloids Surf. A. Physicochem. Eng. Asp. 211(2) , 173-178, (2002)
|
| 3,5-Bis(methoxycarbonyl)benzenesulfonic acid sodium salt |
| Sodium 3,5-bis(methoxycarbonyl)benzenesulfonate |
| 5-Sulfoisophthalic Acid Dimethyl Ester Sodium Salt |
| EINECS 223-578-8 |
| 1,3-Benzenedicarboxylic acid, 5-sulfo-, 1,3-dimethyl ester, sodium salt (1:1) |
| Sodium dimethyl 5-sulphonatoisophthalate |
| 5-Sulfoisophthalic acid, dimethyl ester, sodium salt |
| Dimethyl-5-Sodium Sulfoisophthalate |
| Dimethyl Sodium 5-Sulfoisophthalate |
| MFCD00007493 |
| Dimethyl 5-sulfoisophthalate sodium salt |
| Sodium Dimethyl 5-Sulfoisophthalate |
| Dimethyl 5-Sulfoisophthalate,Sodium Salt |
| sodium,3,5-bis(methoxycarbonyl)benzenesulfonate |