10,11-DIBROMO-10,11-DIHYDRO-5H-DIBENZO[A,D]CYCLOHEPTEN-5-ONE
Modify Date: 2025-08-25 18:18:02
![10,11-DIBROMO-10,11-DIHYDRO-5H-DIBENZO[A,D]CYCLOHEPTEN-5-ONE Structure](https://image.chemsrc.com/caspic/187/39654-52-9.png)
10,11-DIBROMO-10,11-DIHYDRO-5H-DIBENZO[A,D]CYCLOHEPTEN-5-ONE structure
|
Common Name | 10,11-DIBROMO-10,11-DIHYDRO-5H-DIBENZO[A,D]CYCLOHEPTEN-5-ONE | ||
|---|---|---|---|---|
| CAS Number | 39654-52-9 | Molecular Weight | 366.04700 | |
| Density | 1.751g/cm3 | Boiling Point | 395.6ºC at 760 mmHg | |
| Molecular Formula | C15H10Br2O | Melting Point | 213ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 105.4ºC | |
| Name | 10,11-Dibromo-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.751g/cm3 |
|---|---|
| Boiling Point | 395.6ºC at 760 mmHg |
| Melting Point | 213ºC (dec.)(lit.) |
| Molecular Formula | C15H10Br2O |
| Molecular Weight | 366.04700 |
| Flash Point | 105.4ºC |
| Exact Mass | 363.91000 |
| PSA | 17.07000 |
| LogP | 4.80320 |
| Index of Refraction | 1.677 |
| InChIKey | UXTYUOCJQGRAIG-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(Br)C(Br)c2ccccc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| HS Code | 2914700090 |
|
~97%
10,11-DIBROMO-1... CAS#:39654-52-9 |
| Literature: Pich, Kim C.; Bishop, Roger; Craig, Donald C.; Scudder, Marcia L. Australian Journal of Chemistry, 1994 , vol. 47, # 5 p. 837 - 852 |
|
~%
10,11-DIBROMO-1... CAS#:39654-52-9 |
| Literature: Berti Gazzetta Chimica Italiana, 1957 , vol. 87, p. 293,305 |
![4-Bromo-5H-dibenzo[a,d]cyclohepten-5-one structure](https://image.chemsrc.com/caspic/100/17044-50-7.png)
CAS#:17044-50-7| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Propylure |
| 10-Propyl-trans-5,9-tridecadienyl acetate |
| trans-1-Acetoxy-10-(n-propyl)-trideca-5,9-dien (Propylur) |
| trans-1-Acetoxy-10-propyl-tridecadien-(5,9) |
| MFCD00010363 |
| 5,9-Tridecadien-1-ol,10-propyl-,acetate,(E) |
| trans-10,11-dibromodibenzosuberone |
| (5E)-10-Propyl-5,9-tridecadienyl acetate |
| 5,9-Tridecadien-1-ol,10-propyl-,acetate |
| trans-10-n-Propyl-5,9-tridecadienylacetat |
| 1-Acetoxy-10-propyl-tridecadien-(5t,9) |
| (+-)-trans-10,11-Dibrom-10,11-dihydro-dibenzo[a,d]cyclohepten-5-on |
| (+-)-trans-10,11-dibromo-10,11-dihydro-dibenzo[a,d]cyclohepten-5-one |
| trans-10,11-dibromo-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-one |
| 1-Acetoxy-10-n-propyl-trans-5.9-tridecadien |