2-(3,4-dimethoxyphenyl)-N-phenethyl-acetamide structure
|
Common Name | 2-(3,4-dimethoxyphenyl)-N-phenethyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 3972-81-4 | Molecular Weight | 299.36400 | |
| Density | 1.109g/cm3 | Boiling Point | 510.4ºC at 760 mmHg | |
| Molecular Formula | C18H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.5ºC | |
| Name | 2-(3,4-dimethoxyphenyl)-N-(2-phenylethyl)acetamide |
|---|
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 510.4ºC at 760 mmHg |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.36400 |
| Flash Point | 262.5ºC |
| Exact Mass | 299.15200 |
| PSA | 47.56000 |
| LogP | 2.99610 |
| Index of Refraction | 1.554 |
| InChIKey | OMRSESZLILVLQM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)NCCc2ccccc2)cc1OC |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|