Ethyl 2-[(4-chlorobenzoyl)amino]acetate structure
|
Common Name | Ethyl 2-[(4-chlorobenzoyl)amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 39735-52-9 | Molecular Weight | 241.67100 | |
| Density | 1.241g/cm3 | Boiling Point | 396ºC at 760mmHg | |
| Molecular Formula | C11H12ClNO3 | Melting Point | 118-120ºC | |
| MSDS | N/A | Flash Point | 193.3ºC | |
| Name | Ethyl 2-[(4-chlorobenzoyl)amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 396ºC at 760mmHg |
| Melting Point | 118-120ºC |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67100 |
| Flash Point | 193.3ºC |
| Exact Mass | 241.05100 |
| PSA | 55.40000 |
| LogP | 2.02380 |
| Index of Refraction | 1.533 |
| InChIKey | XYVZUPHHGNHQHN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)c1ccc(Cl)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
| Ethyl [(4-chlorobenzoyl)amino]acetate |
| N-(4-chloro)benzoyl glycine methyl ester |
| ethyl 2-(4-chlorobenzamido)acetate |
| ethyl 2-[(4-chlorophenyl)formamido]acetate |
| ethyl 2-[(4-chlorophenyl)carbonylamino]acetate |
| Ethyl N-(4-chlorobenzoyl)aminoacetate |
| 4-chloro-hippuric acid ethyl ester |