2H-Isoindole-2-propanoicacid, 1,3-dihydro-1,3-dioxo-, methyl ester structure
|
Common Name | 2H-Isoindole-2-propanoicacid, 1,3-dihydro-1,3-dioxo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 39739-01-0 | Molecular Weight | 233.22000 | |
| Density | 1.32g/cm3 | Boiling Point | 367.5ºC at 760mmHg | |
| Molecular Formula | C12H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1ºC | |
| Name | methyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 367.5ºC at 760mmHg |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22000 |
| Flash Point | 176.1ºC |
| Exact Mass | 233.06900 |
| PSA | 63.68000 |
| LogP | 0.78360 |
| Index of Refraction | 1.57 |
| InChIKey | IACYEVDEQNXLSN-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN1C(=O)c2ccccc2C1=O |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
| 3-Phthalimido-propionsaeure-methylester |
| F3267-0046 |
| methyl 3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propanoate |