2-[3-(dimethylamino)anilino]benzoic acid structure
|
Common Name | 2-[3-(dimethylamino)anilino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3975-67-5 | Molecular Weight | 256.30000 | |
| Density | 1.244g/cm3 | Boiling Point | 434.7ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | 2-[3-(dimethylamino)anilino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 216.7ºC |
| Exact Mass | 256.12100 |
| PSA | 52.57000 |
| LogP | 3.26740 |
| Index of Refraction | 1.669 |
| InChIKey | DHYYAXTWXTWSAC-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc(Nc2ccccc2C(=O)O)c1 |
|
~%
2-[3-(dimethyla... CAS#:3975-67-5 |
| Literature: Tuttle Journal of the American Chemical Society, 1923 , vol. 45, p. 1914 |
|
~%
2-[3-(dimethyla... CAS#:3975-67-5 |
| Literature: Kaltenbronn; Scherrer; Short; Jones; Beatty; Saka; Winder; Wax; Williamson Arzneimittel-Forschung/Drug Research, 1983 , vol. 33, # 4 A p. 621 - 627 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(3-Dimethylamino-phenyl)-anthranilsaeure |
| N-(3-(Dimethylamino)phenyl)anthranilic acid |
| Anthranilic acid,N-(3-(dimethylamino)phenyl) |
| 3'-Dimethylamino-diphenylamin-carbonsaeure-(2) |