methyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate structure
|
Common Name | methyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 39757-32-9 | Molecular Weight | 266.24700 | |
| Density | 1.25g/cm3 | Boiling Point | 433.6ºC at 760 mmHg | |
| Molecular Formula | C13H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.8ºC | |
| Name | methyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 433.6ºC at 760 mmHg |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.24700 |
| Flash Point | 163.8ºC |
| Exact Mass | 266.07900 |
| PSA | 78.90000 |
| LogP | 1.01870 |
| Index of Refraction | 1.539 |
| InChIKey | WOSJZWHIEQGBCJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1ccc(OC)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2.4-Dimethoxybenzoylbrenztraubensaeure-methylester |
| F3250-0670 |