Methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate
Modify Date: 2025-08-28 09:06:58
Methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate structure
|
Common Name | Methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 39757-35-2 | Molecular Weight | 240.640 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 382.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H9ClO4 | Melting Point | 118-120ºC | |
| MSDS | N/A | Flash Point | 164.9±21.3 °C | |
| Name | methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.0±22.0 °C at 760 mmHg |
| Melting Point | 118-120ºC |
| Molecular Formula | C11H9ClO4 |
| Molecular Weight | 240.640 |
| Flash Point | 164.9±21.3 °C |
| Exact Mass | 240.018936 |
| PSA | 63.60000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | PIULUHUQDVELBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1ccc(Cl)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:553-90-2
CAS#:99-91-2
CAS#:81282-12-4| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 3, Current Page 1 of 1
1
| p-chlorobenzoylpyruvic acid |
| Benzenebutanoic acid, 4-chloro-α,γ-dioxo-, methyl ester |
| Methyl 4-chloro-a,g-dioxo-benzenebutanoate |
| methyl p-chlorobenzoylpyruvate |
| Methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate |