trans-nonachlor structure
|
Common Name | trans-nonachlor | ||
|---|---|---|---|---|
| CAS Number | 39765-80-5 | Molecular Weight | 444.224 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 451.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H5Cl9 | Melting Point | 148℃ | |
| MSDS | Chinese USA | Flash Point | 229.1±24.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | trans-Nonachlor |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.4±40.0 °C at 760 mmHg |
| Melting Point | 148℃ |
| Molecular Formula | C10H5Cl9 |
| Molecular Weight | 444.224 |
| Flash Point | 229.1±24.7 °C |
| Exact Mass | 439.758789 |
| LogP | 5.90 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | OCHOKXCPKDPNQU-JIRPQDPUSA-N |
| SMILES | ClC1=C(Cl)C2(Cl)C3C(Cl)C(Cl)C(Cl)C3C1(Cl)C2(Cl)Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H410 |
| Precautionary Statements | P261-P273-P305 + P351 + P338-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N |
| Risk Phrases | R22;R50;R36/37/38 |
| Safety Phrases | S26;S61 |
| RIDADR | UN 1208 3/PG 2 |
| RTECS | PC0950000 |
|
Are exploited mangrove molluscs exposed to Persistent Organic Pollutant contamination in Senegal, West Africa?
Chemosphere 84(3) , 318-27, (2011) The surface sediments, two bivalves (Arca senilis and Crassostera gasar) and three gastropods (Conus spp., Hexaplex duplex and Pugilina morio) from two Senegalese stations, Falia (Sine-Saloum Estuary)... |
|
|
The mammalian testis accumulates lower levels of organochlorine chemicals compared with other tissues.
Reprod. Toxicol. 15(3) , 333-8, (2001) Tissues were obtained from three separate experiments in order to quantify the tissue distribution of organochlorine chemicals that are thought to be potential reproductive toxicants in males: 1) Spra... |
|
|
Selective bioaccumulation of chlorinated pesticides and metabolites in Arctic seabirds.
Environ. Pollut. 145(2) , 545-53, (2007) Chlorinated pesticides and metabolites (CPs) were quantified in the seabird species: little auk (Alle alle), Brünnich's guillemot (Uria lomvia), black guillemot (Cepphus grylle) and black-legged kitti... |
| T-NONACHLOR |
| trans-nonachlor |
| (1R,2R,3S,3aR,4S,7R,7aS)-1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-1H-4,7-methanoindene |
| (1R,2S,3R,4r,5S,6R,7S)-1,3,4,5,7,8,9,10,10-Nonachlorotricyclo[5.2.1.0]dec-8-ene |
| Enneachlor |
| trans-Nonachlordane |
| (1a,2b,3a,3aa,4b,7b,7aa)-1,2,3,4,5,6,7,8,8-Nonachloro-2,3,3a,4,7,7a-hexahydro-4,7-methano-1H-indene |