6-Phenyl-2-pyridinecarboxylic acid structure
|
Common Name | 6-Phenyl-2-pyridinecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 39774-28-2 | Molecular Weight | 199.205 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 409.0±33.0 °C at 760 mmHg | |
| Molecular Formula | C12H9NO2 | Melting Point | 109°C | |
| MSDS | N/A | Flash Point | 201.1±25.4 °C | |
| Name | 6-Phenylpyridine-2-Carboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.0±33.0 °C at 760 mmHg |
| Melting Point | 109°C |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.205 |
| Flash Point | 201.1±25.4 °C |
| Exact Mass | 199.063324 |
| PSA | 50.19000 |
| LogP | 1.99 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | CXOPUGLYEYDAMC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(-c2ccccc2)n1 |
| Storage condition | 2~8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD04114206 |
| 6-Phenyl-pyridine-2-carboxylic acid |
| 6-Phenylpicolinic acid |
| 2-Pyridinecarboxylic acid, 6-phenyl- |
| 6-Phenyl-2-pyridinecarboxylic acid |
| 6-Phenylpyridine-2-carboxylic acid |
| 6-Phenylpyridine-2-carboxylicacid |